Difference between revisions of "L-GLUTAMATE-5-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
(Created page with "Category:Gene == Gene Ec-16_004670 == * left end position: ** 4783741 * transcription direction: ** NEGATIVE * right end position: ** 4795515 * centisome position: ** 89.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_004670 == |
− | * | + | * left end position: |
− | ** | + | ** 4783741 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4795515 |
− | * | + | * centisome position: |
− | ** | + | ** 89.622536 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0164_0064 |
− | ** | + | ** Esi0164_0064 |
+ | ** CPN | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN0-1061]] |
− | + | ** esiliculosus_genome | |
− | * | + | ***automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=4783741}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4795515}} | |
− | + | {{#set: centisome position=89.622536 }} | |
− | + | {{#set: common name=Esi_0164_0064|Esi0164_0064|CPN}} | |
− | + | {{#set: reaction associated=RXN0-1061}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 21:46, 17 March 2018
Gene Ec-16_004670
- left end position:
- 4783741
- transcription direction:
- NEGATIVE
- right end position:
- 4795515
- centisome position:
- 89.622536
- Synonym(s):
- Esi_0164_0064
- Esi0164_0064
- CPN
Reactions associated
- RXN0-1061
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome