Difference between revisions of "RXN-4733"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == * smiles: ** C(=O)([O-])CNC(=O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M
+
 
* common name:
 
* common name:
−
** 2,4-dinitrophenyl-S-glutathione
+
** gluconeogenesis II (Methanobacterium thermoautotrophicum)
−
* molecular weight:
+
−
** 472.406   
+
 
* Synonym(s):
 
* Synonym(s):
−
** DNP-SG
+
** carbohydrate biosynthesis (Methanobacterium thermoautotrophicum)
−
** S-(2,4-dinitrophenyl)glutathione
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''10''' reactions found over '''14''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[2PGADEHYDRAT-RXN]]
−
* [[GST-RXN]]
+
** 3 associated gene(s):
 +
*** [[Ec-27_004000]]
 +
*** [[Ec-26_004120]]
 +
*** [[Ec-14_005400]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[3PGAREARR-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-24_002670]]
 +
*** [[Ec-03_002170]]
 +
*** [[Ec-27_000330]]
 +
*** [[Ec-03_002160]]
 +
*** [[Ec-01_000980]]
 +
*** [[Ec-06_009930]]
 +
*** [[Ec-10_005410]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[F16ALDOLASE-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-10_000880]]
 +
*** [[Ec-10_004980]]
 +
*** [[Ec-14_001680]]
 +
*** [[Ec-01_008040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-28_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PEPDEPHOS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-26_004170]]
 +
*** [[Ec-12_000950]]
 +
*** [[Ec-06_006860]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PGLUCISOM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_002470]]
 +
*** [[Ec-13_003530]]
 +
*** [[Ec-13_003810]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-23_002710]]
 +
*** [[Ec-15_004230]]
 +
*** [[Ec-18_003420]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-03_001890]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-5224]]
 +
** 8 associated gene(s):
 +
*** [[Ec-05_001290]]
 +
*** [[Ec-10_002770]]
 +
*** [[Ec-27_005680]]
 +
*** [[Ec-07_004610]]
 +
*** [[Ec-16_004700]]
 +
*** [[Ec-22_001150]]
 +
*** [[Ec-06_004120]]
 +
*** [[Ec-03_001960]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-08_000500]]
 +
*** [[Ec-23_004160]]
 +
*** [[Ec-03_002790]]
 +
*** [[Ec-24_000360]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.2.7.6-RXN 1.2.7.6-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-7784 PWY-7784]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-7784 PWY-7784]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R302-RXN R302-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25322932 25322932]
+
{{#set: common name=gluconeogenesis II (Methanobacterium thermoautotrophicum)}}
−
* CHEBI:
+
{{#set: common name=carbohydrate biosynthesis (Methanobacterium thermoautotrophicum)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8927 8927]
+
{{#set: reaction found=10}}
−
* LIGAND-CPD:
+
{{#set: total reaction=14}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11175 C11175]
+
{{#set: completion rate=71.0}}
−
{{#set: smiles=C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)}}
+
−
{{#set: inchi key=InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M}}
+
−
{{#set: common name=2,4-dinitrophenyl-S-glutathione}}
+
−
{{#set: molecular weight=472.406    }}
+
−
{{#set: common name=DNP-SG|S-(2,4-dinitrophenyl)glutathione}}
+
−
{{#set: consumed or produced by=GST-RXN}}
+

Revision as of 20:47, 17 March 2018

Pathway PWY-6142

  • taxonomic range:
  • common name:
    • gluconeogenesis II (Methanobacterium thermoautotrophicum)
  • Synonym(s):
    • carbohydrate biosynthesis (Methanobacterium thermoautotrophicum)

Reaction(s) found

10 reactions found over 14 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-4733&oldid=10344"