Difference between revisions of "RXN0-1461"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] == * smiles: ** CC(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6804 PWY-6804] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6804 PWY-6804] ==
−
* smiles:
+
* taxonomic range:
−
** CC(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
−
* inchi key:
+
−
** InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K
+
 
* common name:
 
* common name:
−
** UDP-N-acetyl-α-D-muramate
+
** diacylglycerol biosynthesis (PUFA enrichment in oilseed)
−
* molecular weight:
+
−
** 676.397   
+
 
* Synonym(s):
 
* Synonym(s):
−
** uridine diphosphate N-acetylmuramic acid
 
−
** UDP-N-acetylmuramic acid
 
−
** UDP-N-acetyl-D-muramate
 
−
** UDP-MurNAc
 
−
** UDP-N-acetylmuramoyl
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
* [[RXN-5781]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12386 RXN-12386]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-58024}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01050 C01050]
+
{{#set: common name=diacylglycerol biosynthesis (PUFA enrichment in oilseed)}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70757 70757]
+
{{#set: total reaction=2}}
−
* BIGG : 36702
+
{{#set: completion rate=50.0}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24772978 24772978]
+
−
* HMDB : HMDB11720
+
−
{{#set: smiles=CC(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K}}
+
−
{{#set: common name=UDP-N-acetyl-α-D-muramate}}
+
−
{{#set: molecular weight=676.397    }}
+
−
{{#set: common name=uridine diphosphate N-acetylmuramic acid|UDP-N-acetylmuramic acid|UDP-N-acetyl-D-muramate|UDP-MurNAc|UDP-N-acetylmuramoyl}}
+
−
{{#set: produced by=UDPNACETYLMURAMATEDEHYDROG-RXN}}
+

Revision as of 20:47, 17 March 2018

Pathway PWY-6804

  • taxonomic range:
  • common name:
    • diacylglycerol biosynthesis (PUFA enrichment in oilseed)
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-1461&oldid=10362"