Difference between revisions of "KDPGALDOL-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY-1 DETOX1-PWY-1] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 T...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY-1 DETOX1-PWY-1] ==
* smiles:
+
* taxonomic range:
** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
** InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
** (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
+
** reactive oxygen species degradation
* molecular weight:
+
** 1073.981   
+
 
* Synonym(s):
 
* Synonym(s):
** docosapentaenoyl-2-enoyl-CoA
+
** removal of superoxide radicals
** (2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-13445]]
+
'''5''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[CATAL-RXN]]
* [[RXN-13444]]
+
** 9 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-07_001420]]
 +
*** [[Ec-07_004600]]
 +
*** [[Ec-02_000470]]
 +
*** [[Ec-00_010030]]
 +
*** [[Ec-05_003380]]
 +
*** [[Ec-00_008210]]
 +
*** [[Ec-00_008230]]
 +
*** [[Ec-11_003410]]
 +
*** [[Ec-00_008240]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DETOX1-PWY]]
 +
** 0 associated gene:
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-05_005450]]
 +
*** [[Ec-09_004680]]
 +
*** [[Ec-11_004010]]
 +
*** [[Ec-00_006580]]
 +
*** [[Ec-08_001740]]
 +
*** [[Ec-14_004400]]
 +
*** [[Ec-05_005460]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12540]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[SUPEROX-DISMUT-RXN]]
 +
** 8 associated gene(s):
 +
*** [[Ec-01_003850]]
 +
*** [[Ec-04_002870]]
 +
*** [[Ec-00_002760]]
 +
*** [[Ec-01_007760]]
 +
*** [[Ec-05_000630]]
 +
*** [[Ec-08_003590]]
 +
*** [[Ec-22_002450]]
 +
*** [[Ec-25_000220]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551532 72551532]
+
{{#set: taxonomic range=TAX-2157}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2759}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76461 76461]
+
{{#set: common name=reactive oxygen species degradation}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=removal of superoxide radicals}}
{{#set: inchi key=InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J}}
+
{{#set: reaction found=5}}
{{#set: common name=(2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA}}
+
{{#set: total reaction=6}}
{{#set: molecular weight=1073.981    }}
+
{{#set: completion rate=83.0}}
{{#set: common name=docosapentaenoyl-2-enoyl-CoA|(2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA}}
+
{{#set: consumed by=RXN-13445}}
+
{{#set: produced by=RXN-13444}}
+

Revision as of 20:47, 17 March 2018

Pathway DETOX1-PWY-1

  • taxonomic range:
  • common name:
    • reactive oxygen species degradation
  • Synonym(s):
    • removal of superoxide radicals

Reaction(s) found

5 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links