Difference between revisions of "Protein-pi-phospho-L-histidines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogena...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
 
* common name:
 
* common name:
−
** Glucose/ribitol dehydrogenase
+
** (2E,7Z)-hexadecenoyl-CoA
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** 997.883   
 
* Synonym(s):
 
* Synonym(s):
 +
** 16:2-Δ2,Δ7-CoA
 +
** 2-trans,7-cis-hexadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17780]]
−
** 1 [[PROTON]][c] '''+''' 1 [[Enoylpimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Pimeloyl-ACP-methyl-esters]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-17779]]
−
** 1 H+[c] '''+''' 1 an enoylpimeloyl-[acp] methyl ester[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a pimeloyl-[acp] methyl ester[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-27_002470]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
−
** '''7''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=Glucose/ribitol dehydrogenase}}
+
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
−
{{#set: ec number=EC-1.3.1.9}}
+
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
−
{{#set: gene associated=Ec-27_002470}}
+
{{#set: molecular weight=997.883    }}
−
{{#set: in pathway=PWY-6519}}
+
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-17780}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN-17779}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 20:47, 17 March 2018

Metabolite CPD-19170

  • smiles:
    • CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
  • common name:
    • (2E,7Z)-hexadecenoyl-CoA
  • molecular weight:
    • 997.883
  • Synonym(s):
    • 16:2-Δ2,Δ7-CoA
    • 2-trans,7-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Protein-pi-phospho-L-histidines&oldid=10376"