Difference between revisions of "ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** diphthamide biosynthesis (archaea) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-14326]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-21_006260]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE--AMMONIA-LIGASE-RXN DIPHTINE--AMMONIA-LIGASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11371 RXN-11371] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=diphthamide biosynthesis (archaea)}} | |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=3}} |
− | {{#set: | + | {{#set: completion rate=33.0}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:47, 17 March 2018
Pathway PWY-6482
- taxonomic range:
- common name:
- diphthamide biosynthesis (archaea)
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-14326
- 1 associated gene(s):
- 1 reconstruction source(s) associated: