Difference between revisions of "CPD-19170"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_PROTON TransportSeed_PROTON] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == React...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_PROTON TransportSeed_PROTON] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
+
* common name:
+
** (2E,7Z)-hexadecenoyl-CoA
+
* molecular weight:
+
** 997.883   
+
 
* Synonym(s):
 
* Synonym(s):
** 16:2-Δ2,Δ7-CoA
 
** 2-trans,7-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17780]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PROTON]][e] '''=>''' 1.0 [[PROTON]][c]
* [[RXN-17779]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 H+[e] '''=>''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
+
{{#set: reconstruction category=manual}}
{{#set: molecular weight=997.883    }}
+
{{#set: reconstruction source=manual-import_from_medium}}
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
{{#set: consumed by=RXN-17780}}
+
{{#set: produced by=RXN-17779}}
+

Revision as of 21:48, 17 March 2018

Reaction TransportSeed_PROTON

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[e] => 1.0 H+[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links