Difference between revisions of "Cis-delta9-3-hydroxymontanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] == * smiles: ** C1(O)(C(OP([O-])([O-...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859] ==
−
* smiles:
+
* taxonomic range:
−
** C1(O)(C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=MMWCIQZXVOZEGG-XJTPDSDZSA-H
+
 
* common name:
 
* common name:
−
** D-myo-inositol (1,4,5)-trisphosphate
+
** all-trans-farnesol biosynthesis
−
* molecular weight:
+
−
** 414.049   
+
 
* Synonym(s):
 
* Synonym(s):
−
** inositol (1,4,5)-trisphosphate
+
** trans,trans-farnesol biosynthesis
−
** 1D-myo-inositol (1,4,5)-trisphosphate
+
−
** Ins(1,4,5)P3
+
−
** I(1,4,5)P3
+
−
** InsP3
+
−
** IP3
+
−
** triphosphoinositol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[3.1.3.56-RXN]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
−
* [[2.7.1.127-RXN]]
+
* [[FPPSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 3 associated gene(s):
−
* [[3.1.4.11-RXN]]
+
*** [[Ec-07_006170]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_003020]]
 +
*** [[Ec-16_004330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GPPSYN-RXN]]
 +
** 12 associated gene(s):
 +
*** [[Ec-07_006170]]
 +
*** [[Ec-16_004330]]
 +
*** [[Ec-08_002270]]
 +
*** [[Ec-10_003020]]
 +
*** [[Ec-00_007350]]
 +
*** [[Ec-14_006550]]
 +
*** [[Ec-24_003910]]
 +
*** [[Ec-26_003280]]
 +
*** [[Ec-21_000990]]
 +
*** [[Ec-25_002110]]
 +
*** [[Ec-17_001240]]
 +
*** [[Ec-18_000990]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[IPPISOM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-11_001030]]
 +
*** [[Ec-18_002690]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8617 RXN-8617]
 
== External links  ==
 
== External links  ==
−
* CAS : 85166-31-0
+
{{#set: taxonomic range=TAX-2759}}
−
* CAS : 88269-39-0
+
{{#set: common name=all-trans-farnesol biosynthesis}}
−
* Wikipedia : Inositol_triphosphate
+
{{#set: common name=trans,trans-farnesol biosynthesis}}
−
* PUBCHEM:
+
{{#set: reaction found=3}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21761708 21761708]
+
{{#set: total reaction=4}}
−
* HMDB : HMDB01498
+
{{#set: completion rate=75.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01245 C01245]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10375590.html 10375590]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=203600 203600]
+
−
* METABOLIGHTS : MTBLC203600
+
−
{{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)}}
+
−
{{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-XJTPDSDZSA-H}}
+
−
{{#set: common name=D-myo-inositol (1,4,5)-trisphosphate}}
+
−
{{#set: molecular weight=414.049    }}
+
−
{{#set: common name=inositol (1,4,5)-trisphosphate|1D-myo-inositol (1,4,5)-trisphosphate|Ins(1,4,5)P3|I(1,4,5)P3|InsP3|IP3|triphosphoinositol}}
+
−
{{#set: consumed by=3.1.3.56-RXN|2.7.1.127-RXN}}
+
−
{{#set: produced by=3.1.4.11-RXN}}
+

Revision as of 20:48, 17 March 2018

Pathway PWY-6859

  • taxonomic range:
  • common name:
    • all-trans-farnesol biosynthesis
  • Synonym(s):
    • trans,trans-farnesol biosynthesis

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Cis-delta9-3-hydroxymontanoyl-ACPs&oldid=10448"