Difference between revisions of "Ec-14 001390"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N |
* common name: | * common name: | ||
− | ** | + | ** demethylmenaquinol-8 |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 705.118 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-demethylmenaquinol-8 |
− | ** | + | ** DMKH2-8 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479277 45479277] |
− | {{#set: smiles=C( | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61873 61873] |
− | {{#set: common name= | + | * BIGG : 1438263 |
− | {{#set: molecular weight= | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N}} |
− | {{#set: consumed by=RXN | + | {{#set: common name=demethylmenaquinol-8}} |
+ | {{#set: molecular weight=705.118 }} | ||
+ | {{#set: common name=2-demethylmenaquinol-8|DMKH2-8}} | ||
+ | {{#set: consumed by=ADOMET-DMK-METHYLTRANSFER-RXN}} |
Revision as of 20:49, 17 March 2018
Contents
Metabolite CPD-12115
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))
- inchi key:
- InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N
- common name:
- demethylmenaquinol-8
- molecular weight:
- 705.118
- Synonym(s):
- 2-demethylmenaquinol-8
- DMKH2-8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links