Difference between revisions of "PWY4FS-13"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6941 PWY-6941] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6941 PWY-6941] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** styrene degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | * [[ | + | * [[PHENDEHYD-RXN]] |
| − | == Reaction(s) | + | ** 0 associated gene: |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[annotation-esiliculosus_genome]] |
| − | + | == Reaction(s) not found == | |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12764 RXN-12764] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12765 RXN-12765] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=styrene degradation}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 20:51, 17 March 2018
Pathway PWY-6941
- taxonomic range:
- common name:
- styrene degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- PHENDEHYD-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
