Difference between revisions of "Ec-08 003340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-46 PWY-46] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] ** [ht...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-46 PWY-46] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
+
 
* common name:
 
* common name:
** leukotriene-D4
+
** putrescine biosynthesis III
* molecular weight:
+
** 495.653   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** ODC pathway
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''1''' reactions in the full pathway
* [[RXN66-336]]
+
* [[ORNDECARBOX-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-11_003270]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-46 PWY-46]
* CHEBI:
+
* ARACYC:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-46 PWY-46]
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}}
+
{{#set: taxonomic range=TAX-2759}}
{{#set: common name=leukotriene-D4}}
+
{{#set: common name=putrescine biosynthesis III}}
{{#set: molecular weight=495.653    }}
+
{{#set: common name=ODC pathway}}
{{#set: produced by=RXN66-336}}
+
{{#set: reaction found=1}}
 +
{{#set: total reaction=1}}
 +
{{#set: completion rate=100.0}}

Revision as of 20:51, 17 March 2018

Pathway PWY-46

  • taxonomic range:
  • common name:
    • putrescine biosynthesis III
  • Synonym(s):
    • ODC pathway

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links