Difference between revisions of "CPD3DJ-11366"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-27_001180 == * left end position: ** 977561 * transcription direction: ** POSITIVE * right end position: ** 982063 * centisome position: ** 15.156...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-27_001180 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] ==
−
* left end position:
+
* smiles:
−
** 977561
+
** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
−
* right end position:
+
* common name:
−
** 982063
+
** ε-carotene
−
* centisome position:
+
* molecular weight:
−
** 15.156203    
+
** 536.882    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0263_0034
+
** ε,ε-carotene
−
** Esi0263_0034
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.2.1.39-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-8028]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=977561}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808]
−
{{#set: right end position=982063}}
+
* LIGAND-CPD:
−
{{#set: centisome position=15.156203   }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276]
−
{{#set: common name=Esi_0263_0034|Esi0263_0034}}
+
{{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}}
−
{{#set: reaction associated=3.2.1.39-RXN}}
+
{{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}}
 +
{{#set: common name=ε-carotene}}
 +
{{#set: molecular weight=536.882   }}
 +
{{#set: common name=ε,ε-carotene}}
 +
{{#set: produced by=RXN-8028}}

Revision as of 20:52, 17 March 2018

Metabolite CPD-7414

  • smiles:
    • CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
  • inchi key:
    • InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
  • common name:
    • ε-carotene
  • molecular weight:
    • 536.882
  • Synonym(s):
    • ε,ε-carotene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD3DJ-11366&oldid=10722"