Difference between revisions of "RXN-14273"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == * smiles: ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11))))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H |
* common name: | * common name: | ||
| − | ** | + | ** adenosyl-cobyrinate a,c-diamide |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1182.137 |
* Synonym(s): | * Synonym(s): | ||
| + | ** adenosyl-cobyrinic acid a,c-diamide | ||
| + | ** Adenosyl cobyrinate diamide | ||
| + | ** Adenosylcob(III)yrinic acid a,c-diamide | ||
| + | ** Adenosylcobyrinic acid a,c-diamide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[R344-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819815 91819815] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58503 58503] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06506 C06506] |
| − | {{#set: produced by= | + | * HMDB : HMDB01083 |
| + | {{#set: smiles=CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))}} | ||
| + | {{#set: inchi key=InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H}} | ||
| + | {{#set: common name=adenosyl-cobyrinate a,c-diamide}} | ||
| + | {{#set: molecular weight=1182.137 }} | ||
| + | {{#set: common name=adenosyl-cobyrinic acid a,c-diamide|Adenosyl cobyrinate diamide|Adenosylcob(III)yrinic acid a,c-diamide|Adenosylcobyrinic acid a,c-diamide}} | ||
| + | {{#set: produced by=R344-RXN}} | ||
Revision as of 20:53, 17 March 2018
Contents
Metabolite CPD-690
- smiles:
- CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))
- inchi key:
- InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H
- common name:
- adenosyl-cobyrinate a,c-diamide
- molecular weight:
- 1182.137
- Synonym(s):
- adenosyl-cobyrinic acid a,c-diamide
- Adenosyl cobyrinate diamide
- Adenosylcob(III)yrinic acid a,c-diamide
- Adenosylcobyrinic acid a,c-diamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))" cannot be used as a page name in this wiki.
