Difference between revisions of "RXN-16475"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 6-deoxocathasterone |
| + | * molecular weight: | ||
| + | ** 418.702 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** deoxocathasterone |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN-773]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIPID_MAPS : LMST01030124 | |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202530 25202530] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798] |
| + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}} | ||
| + | {{#set: common name=6-deoxocathasterone}} | ||
| + | {{#set: molecular weight=418.702 }} | ||
| + | {{#set: common name=deoxocathasterone}} | ||
| + | {{#set: produced by=RXN-773}} | ||
Revision as of 20:54, 17 March 2018
Contents
Metabolite CPD-712
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
- common name:
- 6-deoxocathasterone
- molecular weight:
- 418.702
- Synonym(s):
- deoxocathasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
