Difference between revisions of "RXN1G-499"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...")
 
(Created page with "Category:Gene == Gene Ec-09_003490 == * left end position: ** 3961085 * transcription direction: ** POSITIVE * right end position: ** 3969900 * centisome position: ** 70.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+
== Gene Ec-09_003490 ==
−
* smiles:
+
* left end position:
−
** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
+
** 3961085
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** thyroxine sulfate
+
** 3969900
−
* molecular weight:
+
* centisome position:
−
** 855.924    
+
** 70.56782    
 
* Synonym(s):
 
* Synonym(s):
−
** T4 sulfate
+
** Esi_0021_0062
−
** thyroxine-4-sulfate
+
** Esi0021_0062
−
** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
+
** PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RXN-10614]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3961085}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3969900}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910]
+
{{#set: centisome position=70.56782   }}
−
{{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}}
+
{{#set: common name=Esi_0021_0062|Esi0021_0062|PK}}
−
{{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: common name=thyroxine sulfate}}
+
−
{{#set: molecular weight=855.924   }}
+
−
{{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}}
+
−
{{#set: produced by=RXN-10614}}
+

Revision as of 20:55, 17 March 2018

Gene Ec-09_003490

  • left end position:
    • 3961085
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3969900
  • centisome position:
    • 70.56782
  • Synonym(s):
    • Esi_0021_0062
    • Esi0021_0062
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN1G-499&oldid=10877"