Difference between revisions of "RXN66-550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...")
 
(Created page with "Category:Gene == Gene Ec-00_005920 == * left end position: ** 9436510 * transcription direction: ** POSITIVE * right end position: ** 9442064 * centisome position: ** 49.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
+
== Gene Ec-00_005920 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 9436510
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 6-deoxocathasterone
+
** 9442064
−
* molecular weight:
+
* centisome position:
−
** 418.702    
+
** 49.806263    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxocathasterone
+
** Esi_0475_0006
 +
** Esi0475_0006
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[CHD-RXN]]
−
* [[RXN-773]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
* [[RXN0-7230]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[CHOLINE-BETAINE-ANA-PWY]]
 +
* [[BETSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01030124
+
{{#set: left end position=9436510}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202530 25202530]
+
{{#set: right end position=9442064}}
−
* CHEBI:
+
{{#set: centisome position=49.806263   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714]
+
{{#set: common name=Esi_0475_0006|Esi0475_0006}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=CHD-RXN|RXN0-7230}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798]
+
{{#set: pathway associated=CHOLINE-BETAINE-ANA-PWY|BETSYN-PWY}}
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}}
+
−
{{#set: common name=6-deoxocathasterone}}
+
−
{{#set: molecular weight=418.702   }}
+
−
{{#set: common name=deoxocathasterone}}
+
−
{{#set: produced by=RXN-773}}
+

Revision as of 21:55, 17 March 2018

Gene Ec-00_005920

  • left end position:
    • 9436510
  • transcription direction:
    • POSITIVE
  • right end position:
    • 9442064
  • centisome position:
    • 49.806263
  • Synonym(s):
    • Esi_0475_0006
    • Esi0475_0006

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-550&oldid=10907"