Difference between revisions of "CPD-712"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * inchi key: ** In...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6599 PWY-6599] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6599 PWY-6599] ==
* smiles:
+
* taxonomic range:
** CC(C(=O)C([O-])=O)(CO)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 2-dehydropantoate
+
** guanine and guanosine salvage II
* molecular weight:
+
** 145.135   
+
 
* Synonym(s):
 
* Synonym(s):
** ketopantoate
 
** 2-ketopantoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GUANPRIBOSYLTRAN-RXN]]
* [[RXN-15635]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_006480]]
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-366]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB03795
+
{{#set: taxonomic range=TAX-2759}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619]
+
{{#set: common name=guanine and guanosine salvage II}}
* LIGAND-CPD:
+
{{#set: reaction found=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966]
+
{{#set: total reaction=2}}
* CHEMSPIDER:
+
{{#set: completion rate=100.0}}
** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561]
+
* BIGG : 36502
+
{{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}}
+
{{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}}
+
{{#set: common name=2-dehydropantoate}}
+
{{#set: molecular weight=145.135    }}
+
{{#set: common name=ketopantoate|2-ketopantoate}}
+
{{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}}
+
{{#set: produced by=RXN-15635}}
+
{{#set: consumed or produced by=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN}}
+

Revision as of 20:55, 17 March 2018

Pathway PWY-6599

  • taxonomic range:
  • common name:
    • guanine and guanosine salvage II
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links