Difference between revisions of "Ec-10 006110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-PALMITOYLGLYCEROL-3-PHOSPHATE 1-PALMITOYLGLYCEROL-3-PHOSPHATE] == * smiles: ** CCCCCCCCCCCCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-PALMITOYLGLYCEROL-3-PHOSPHATE 1-PALMITOYLGLYCEROL-3-PHOSPHATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YNDYKPRNFWPPFU-GOSISDBHSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 1-palmitoylglycerol 3-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 408.471 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17010]] |
| − | * [[RXN- | + | * [[RXN-17012]] |
| + | * [[RXN-17014]] | ||
| + | * [[RXN-17008]] | ||
| + | * [[RXN0-6705]] | ||
| + | * [[RXN-17023]] | ||
| + | * [[RXN-17024]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17018]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04036 C04036] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57518 57518] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC57518 |
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173172 46173172] |
| − | {{#set: common name= | + | * BIGG : 2617399 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-]}} |
| − | + | {{#set: inchi key=InChIKey=YNDYKPRNFWPPFU-GOSISDBHSA-L}} | |
| − | {{#set: consumed by=RXN- | + | {{#set: common name=1-palmitoylglycerol 3-phosphate}} |
| − | + | {{#set: molecular weight=408.471 }} | |
| − | {{#set: | + | {{#set: consumed by=RXN-17010|RXN-17012|RXN-17014|RXN-17008|RXN0-6705|RXN-17023|RXN-17024}} |
| + | {{#set: produced by=RXN-17018}} | ||
Revision as of 20:56, 17 March 2018
Contents
Metabolite 1-PALMITOYLGLYCEROL-3-PHOSPHATE
- smiles:
- CCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-]
- inchi key:
- InChIKey=YNDYKPRNFWPPFU-GOSISDBHSA-L
- common name:
- 1-palmitoylglycerol 3-phosphate
- molecular weight:
- 408.471
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
