Difference between revisions of "Ec-25 003740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9550 RXN-9550] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9550 RXN-9550] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.1.2.14 EC-3.1.2.14]
+
** InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
 +
* common name:
 +
** 4-hydroxy-2-nonenal-[L-Cys] conjugate
 +
* molecular weight:
 +
** 277.378   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Palmitoleoyl-ACPs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-9245]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-13677]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a palmitoleoyl-[acp][c] '''+''' 1 H2O[c] '''=>''' 1 palmitoleate[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5366]], palmitoleate biosynthesis II (plants and bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08162 R08162]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657989 90657989]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]}}
−
{{#set: ec number=EC-3.1.2.14}}
+
{{#set: inchi key=InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N}}
−
{{#set: in pathway=PWY-5366|PWY-6282}}
+
{{#set: common name=4-hydroxy-2-nonenal-[L-Cys] conjugate}}
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: molecular weight=277.378    }}
−
{{#set: reconstruction tool=meneco}}
+
{{#set: produced by=RXN-13677}}
−
{{#set: reconstruction source=added for gapfilling}}
+

Revision as of 20:56, 17 March 2018

Metabolite CPD-14706

  • smiles:
    • CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
  • common name:
    • 4-hydroxy-2-nonenal-[L-Cys] conjugate
  • molecular weight:
    • 277.378
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
"4-hydroxy-2-nonenal-[L-Cys] conjugate" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-25_003740&oldid=10944"