Difference between revisions of "Ec-06 003770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5493 PWY-5493] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5493 PWY-5493] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** reductive monocarboxylic acid cycle
* molecular weight:
+
** 429.662   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** reductive monocarboxylate cycle
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-23]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PYRUFLAVREDUCT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-23_002710]]
 +
*** [[Ec-15_004230]]
 +
*** [[Ec-18_003420]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PYRUVFORMLY-RXN PYRUVFORMLY-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200717 25200717]
+
{{#set: common name=reductive monocarboxylic acid cycle}}
* HMDB : HMDB12166
+
{{#set: common name=reductive monocarboxylate cycle}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
+
{{#set: total reaction=2}}
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
+
{{#set: completion rate=50.0}}
{{#set: molecular weight=429.662    }}
+
{{#set: consumed by=RXN66-23}}
+

Revision as of 20:56, 17 March 2018

Pathway PWY-5493

  • taxonomic range:
  • common name:
    • reductive monocarboxylic acid cycle
  • Synonym(s):
    • reductive monocarboxylate cycle

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links