|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMINESYN-RXN GLUTAMINESYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-]) |
| + | * inchi key: |
| + | ** InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J |
| * common name: | | * common name: |
− | ** Glutamine synthetase, beta-Grasp | + | ** α-glucose 1,6-bisphosphate |
− | ** glutamate-ammonia ligase | + | * molecular weight: |
− | ** Glutamine synthetase/guanido kinase, catalytic domain
| + | ** 336.085 |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/6.3.1.2 EC-6.3.1.2] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** α-D-glucose 1,6-P2 |
| + | ** α-D-glucopyranose 1,6-bisphosphate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[GLT]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''=>''' 1 [[GLN]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-16997]] |
− | ** 1 L-glutamate[c] '''+''' 1 ATP[c] '''+''' 1 ammonium[c] '''=>''' 1 L-glutamine[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
| + | * [[RXN-16998]] |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-21_003610]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-09_000640]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | * [[Ec-15_004110]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-15_004120]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | == Pathways == | + | |
− | * [[GLNSYN-PWY]], L-glutamine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLNSYN-PWY GLNSYN-PWY]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY-5675]], nitrate reduction V (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5675 PWY-5675]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-381]], nitrate reduction II (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
| + | |
− | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-6964]], ammonia assimilation cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6964 PWY-6964] | + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY490-3]], nitrate reduction VI (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3] | + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6963]], ammonia assimilation cycle I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6963 PWY-6963]
| + | |
− | ** '''4''' reactions found over '''6''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[aragem]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 10139-18-1 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16169 16169]
| + | * PUBCHEM: |
− | * LIGAND-RXN:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201676 25201676] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00253 R00253]
| + | * CHEBI: |
− | * UNIPROT: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58392 58392] |
− | ** [http://www.uniprot.org/uniprot/P15103 P15103] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P15124 P15124]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01231 C01231] |
− | ** [http://www.uniprot.org/uniprot/P15623 P15623]
| + | * HMDB : HMDB03514 |
− | ** [http://www.uniprot.org/uniprot/P21154 P21154] | + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])}} |
− | ** [http://www.uniprot.org/uniprot/P45627 P45627] | + | {{#set: inchi key=InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J}} |
− | ** [http://www.uniprot.org/uniprot/Q59982 Q59982]
| + | {{#set: common name=α-glucose 1,6-bisphosphate}} |
− | ** [http://www.uniprot.org/uniprot/Q7M314 Q7M314]
| + | {{#set: molecular weight=336.085 }} |
− | ** [http://www.uniprot.org/uniprot/Q60182 Q60182] | + | {{#set: common name=α-D-glucose 1,6-P2|α-D-glucopyranose 1,6-bisphosphate}} |
− | ** [http://www.uniprot.org/uniprot/P04078 P04078] | + | {{#set: reversible reaction associated=RXN-16997|RXN-16998}} |
− | ** [http://www.uniprot.org/uniprot/P00964 P00964] | + | |
− | ** [http://www.uniprot.org/uniprot/P22248 P22248]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07804 P07804]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13564 P13564]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12425 P12425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19064 P19064]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16580 P16580]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10656 P10656]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11600 P11600]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A1P6 P0A1P6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9C5 P0A9C5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00965 P00965]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04771 P04771]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04770 P04770]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15102 P15102]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10583 P10583]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23712 P23712]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15105 P15105]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08282 P08282]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08281 P08281]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07694 P07694]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09606 P09606]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14654 P14654]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14655 P14655]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14656 P14656]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22878 P22878]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19432 P19432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15106 P15106]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19904 P19904]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14636 P14636]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04772 P04772]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09826 P09826]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05457 P05457]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JSU6 Q9JSU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PPK8 Q9PPK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66514 O66514]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8X7G0 Q8X7G0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CDL9 Q9CDL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05650 Q05650]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43794 P43794]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31592 P31592]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27747 Q27747]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12424 P12424]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04831 Q04831]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24099 P24099]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04998 O04998]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04999 O04999]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20479 P20479]
| + | |
− | ** [http://www.uniprot.org/uniprot/O75014 O75014]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23794 P23794]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43127 Q43127]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9FHR0 Q9FHR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9C8C7 Q9C8C7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28786 P28786]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02154 Q02154]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05542 Q05542]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42624 Q42624]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43518 P43518]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52783 P52783]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43759 Q43759]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38559 P38559]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38560 P38560]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38561 P38561]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38562 P38562]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38563 P38563]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25462 P25462]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42625 Q42625]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46410 P46410]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42802 Q42802]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42623 Q42623]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q53045 Q53045]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32288 P32288]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43066 Q43066]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59195 Q59195]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51118 P51118]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51119 P51119]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42950 Q42950]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42951 Q42951]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07939 Q07939]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43760 Q43760]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42688 Q42688]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42689 Q42689]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22504 O22504]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22505 O22505]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22506 O22506]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59972 Q59972]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UWN1 Q9UWN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RDW7 Q9RDW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43386 P43386]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A040 P0A040]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=Glutamine synthetase, beta-Grasp}} | + | |
− | {{#set: common name=glutamate-ammonia ligase}} | + | |
− | {{#set: common name=Glutamine synthetase/guanido kinase, catalytic domain}} | + | |
− | {{#set: ec number=EC-6.3.1.2}}
| + | |
− | {{#set: gene associated=Ec-21_003610|Ec-09_000640|Ec-15_004110|Ec-15_004120}}
| + | |
− | {{#set: in pathway=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY490-3|PWY-6963}} | + | |
− | {{#set: reconstruction category=orthology}}
| + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=aragem}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |