Difference between revisions of "Ec-21 004790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKKKJIJFFOK-VFU...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-OXYGENASE-RXN MYO-INOSITOL-OXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-OXYGENASE-RXN MYO-INOSITOL-OXYGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** inositol oxygenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.13.99.1 EC-1.13.99.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[MYO-INOSITOL]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[D-Glucopyranuronate]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 myo-inositol[c] '''+''' 1 oxygen[c] '''=>''' 1 H+[c] '''+''' 1 H2O[c] '''+''' 1 D-glucopyranuronate[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-09_002560]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***GO-TERM | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-4841]], UDP-α-D-glucuronate biosynthesis (from myo-inositol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4841 PWY-4841] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23696 23696] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01184 R01184] | |
− | ** [http:// | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=inositol oxygenase}} | |
− | * LIGAND- | + | {{#set: ec number=EC-1.13.99.1}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-09_002560}} |
− | + | {{#set: in pathway=PWY-4841}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:58, 17 March 2018
Contents
Reaction MYO-INOSITOL-OXYGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- inositol oxygenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MYO-INOSITOL[c] + 1 OXYGEN-MOLECULE[c] => 1 PROTON[c] + 1 WATER[c] + 1 D-Glucopyranuronate[c]
- With common name(s):
- 1 myo-inositol[c] + 1 oxygen[c] => 1 H+[c] + 1 H2O[c] + 1 D-glucopyranuronate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-09_002560
- ESILICULOSUS_GENOME
- GO-TERM
- pantograph-aragem
- ESILICULOSUS_GENOME
Pathways
- PWY-4841, UDP-α-D-glucuronate biosynthesis (from myo-inositol): PWY-4841
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links