Difference between revisions of "DNA-6-Methyl-Amino-Purines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-KIN-RXN GLYCEROL-KIN-RXN] == * direction: ** REVERSIBLE * common name: ** Carbohydrate kin...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-KIN-RXN GLYCEROL-KIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
 
* common name:
 
* common name:
−
** Carbohydrate kinase, FGGY, C-terminal
+
** 5-dehydroavenasterol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.30 EC-2.7.1.30]
+
** 410.682   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-4210]]
−
** 1 [[GLYCEROL]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-4209]]
−
** 1 glycerol[c] '''+''' 1 ATP[c] '''<=>''' 1 sn-glycerol 3-phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_004370]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21644 21644]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724575 23724575]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00847 R00847]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P18157 P18157]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783]
−
** [http://www.uniprot.org/uniprot/P47284 P47284]
+
* HMDB : HMDB06852
−
** [http://www.uniprot.org/uniprot/Q9CG64 Q9CG64]
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
** [http://www.uniprot.org/uniprot/Q9V207 Q9V207]
+
{{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}}
−
** [http://www.uniprot.org/uniprot/P44400 P44400]
+
{{#set: common name=5-dehydroavenasterol}}
−
** [http://www.uniprot.org/uniprot/Q9WX53 Q9WX53]
+
{{#set: molecular weight=410.682    }}
−
** [http://www.uniprot.org/uniprot/Q7M0X5 Q7M0X5]
+
{{#set: consumed by=RXN-4210}}
−
** [http://www.uniprot.org/uniprot/P0A6F3 P0A6F3]
+
{{#set: produced by=RXN-4209}}
−
** [http://www.uniprot.org/uniprot/P25013 P25013]
+
−
** [http://www.uniprot.org/uniprot/P19255 P19255]
+
−
** [http://www.uniprot.org/uniprot/P32190 P32190]
+
−
** [http://www.uniprot.org/uniprot/P32189 P32189]
+
−
** [http://www.uniprot.org/uniprot/P95907 P95907]
+
−
** [http://www.uniprot.org/uniprot/Q49011 Q49011]
+
−
** [http://www.uniprot.org/uniprot/O93623 O93623]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=Carbohydrate kinase, FGGY, C-terminal}}
+
−
{{#set: ec number=EC-2.7.1.30}}
+
−
{{#set: gene associated=Ec-21_004370}}
+
−
{{#set: in pathway=PWY-4261}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 20:59, 17 March 2018

Metabolite CPD-4126

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
  • common name:
    • 5-dehydroavenasterol
  • molecular weight:
    • 410.682
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DNA-6-Methyl-Amino-Purines&oldid=11144"