Difference between revisions of "Ec-01 003960"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** GDP-mannose biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''4''' reactions found over '''4''' reactions in the full pathway |
− | + | * [[2.7.7.13-RXN]] | |
− | * [[ | + | ** 0 associated gene: |
− | + | ** 1 reconstruction source(s) associated: | |
− | * [[RXN- | + | *** [[annotation-esiliculosus_genome]] |
+ | * [[MANNPISOM-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-20_000830]] | ||
+ | *** [[Ec-27_005440]] | ||
+ | *** [[Ec-28_000050]] | ||
+ | *** [[Ec-28_000080]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PGLUCISOM-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-24_002470]] | ||
+ | *** [[Ec-13_003530]] | ||
+ | *** [[Ec-13_003810]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[PHOSMANMUT-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-08_004630]] | ||
+ | *** [[Ec-17_001480]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5659 PWY-5659] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2157}} |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=GDP-mannose biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:59, 17 March 2018
Pathway PWY-5659
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- 2.7.7.13-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- MANNPISOM-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- PGLUCISOM-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- PHOSMANMUT-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: