Difference between revisions of "Ec-01 003960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659] ==
−
* smiles:
+
* taxonomic range:
−
** [CH](=O)CCCC([N+])C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** (S)-2-amino-6-oxohexanoate
+
** GDP-mannose biosynthesis
−
* molecular weight:
+
−
** 145.158   
+
 
* Synonym(s):
 
* Synonym(s):
−
** allysine
 
−
** L-2-aminoadipate 6-semialdehyde
 
−
** 2-aminoadipate 6-semialdehyde
 
−
** α-aminoadipate 6-semialdehyde
 
−
** 2-aminoadipate semialdehyde
 
−
** L-allysine
 
−
** (S)-2-aminoadipate 6-semialdehyde
 
−
** 2-aminoadipate-6-semialdehyde
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[1.2.1.31-RXN]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.7.13-RXN]]
−
* [[1.5.1.9-RXN]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[RXN-8173]]
+
*** [[annotation-esiliculosus_genome]]
 +
* [[MANNPISOM-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-20_000830]]
 +
*** [[Ec-27_005440]]
 +
*** [[Ec-28_000050]]
 +
*** [[Ec-28_000080]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PGLUCISOM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_002470]]
 +
*** [[Ec-13_003530]]
 +
*** [[Ec-13_003810]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PHOSMANMUT-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-08_004630]]
 +
*** [[Ec-17_001480]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 1962-83-0
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5659 PWY-5659]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688062 36688062]
+
{{#set: taxonomic range=TAX-2157}}
−
* HMDB : HMDB59595
+
{{#set: taxonomic range=TAX-2759}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04076 C04076]
+
{{#set: common name=GDP-mannose biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58321 58321]
+
{{#set: total reaction=4}}
−
* METABOLIGHTS : MTBLC58321
+
{{#set: completion rate=100.0}}
−
{{#set: smiles=[CH](=O)CCCC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N}}
+
−
{{#set: common name=(S)-2-amino-6-oxohexanoate}}
+
−
{{#set: molecular weight=145.158    }}
+
−
{{#set: common name=allysine|L-2-aminoadipate 6-semialdehyde|2-aminoadipate 6-semialdehyde|α-aminoadipate 6-semialdehyde|2-aminoadipate semialdehyde|L-allysine|(S)-2-aminoadipate 6-semialdehyde|2-aminoadipate-6-semialdehyde}}
+
−
{{#set: consumed by=1.2.1.31-RXN}}
+
−
{{#set: produced by=1.5.1.9-RXN}}
+
−
{{#set: consumed or produced by=RXN-8173}}
+

Revision as of 20:59, 17 March 2018

Pathway PWY-5659

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_003960&oldid=11164"