Difference between revisions of "UTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Elongation-tRNAMet Elongation-tRNAMet] == * common name: ** elongator tRNAmet * Synonym(s): **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == * smiles: ** CC1(N=CC(COP...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == |
| + | * smiles: | ||
| + | ** CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N) | ||
| + | * inchi key: | ||
| + | ** InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine |
| + | * molecular weight: | ||
| + | ** 217.121 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4-amino-5-phosphomethyl-2-methylpyrimidine |
| − | ** | + | ** HMP-P |
| + | ** 4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PYRIMSYN3-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244846 25244846] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58354 58354] | ||
| + | * BIGG : 44041 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04556 C04556] | ||
| + | {{#set: smiles=CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)}} | ||
| + | {{#set: inchi key=InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}} | ||
| + | {{#set: molecular weight=217.121 }} | ||
| + | {{#set: common name=4-amino-5-phosphomethyl-2-methylpyrimidine|HMP-P|4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate}} | ||
| + | {{#set: consumed by=PYRIMSYN3-RXN}} | ||
Revision as of 20:59, 17 March 2018
Contents
Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P
- smiles:
- CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)
- inchi key:
- InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L
- common name:
- 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
- molecular weight:
- 217.121
- Synonym(s):
- 4-amino-5-phosphomethyl-2-methylpyrimidine
- HMP-P
- 4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)" cannot be used as a page name in this wiki.
