Difference between revisions of "P321-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACONITATEHYDR-RXN ACONITATEHYDR-RXN] == * direction: ** REVERSIBLE * common name: ** cis-aconitate...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACONITATEHYDR-RXN ACONITATEHYDR-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2)
 +
* inchi key:
 +
** InChIKey=DXDRHHKMWQZJHT-FPYGCLRLSA-N
 
* common name:
 
* common name:
−
** cis-aconitate hydratase
+
** isoliquiritigenin
−
** Aconitate hydratase,
+
* molecular weight:
−
** Aconitase/3-isopropylmalate dehydratase, swivel
+
** 256.257   
 
* Synonym(s):
 
* Synonym(s):
 +
** 42'4'-trihydroxychalcone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-3221]]
−
** 1 [[WATER]][c] '''+''' 1 [[CIS-ACONITATE]][c] '''<=>''' 1 [[THREO-DS-ISO-CITRATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-3142]]
−
** 1 H2O[c] '''+''' 1 cis-aconitate[c] '''<=>''' 1 D-threo-isocitrate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-16_001000]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-12_000170]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
+
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
+
−
** '''10''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5392]], reductive TCA cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392]
+
−
** '''6''' reactions found over '''12''' reactions in the full pathway
+
−
* [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
+
−
** '''9''' reactions found over '''10''' reactions in the full pathway
+
−
* [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
+
−
** '''10''' reactions found over '''12''' reactions in the full pathway
+
−
* [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
+
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
−
* [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
* [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
+
−
** '''8''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
+
−
** '''11''' reactions found over '''18''' reactions in the full pathway
+
−
* [[REDCITCYC]], TCA cycle VIII (helicobacter): [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC]
+
−
** '''5''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7124]], ethylene biosynthesis V (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7124 PWY-7124]
+
−
** '''8''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
+
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* DRUGBANK : DB03285
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22144 22144]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=638278 638278]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01900 R01900]
+
* HMDB : HMDB37316
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: common name=cis-aconitate hydratase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08650 C08650]
−
{{#set: common name=Aconitate hydratase,}}
+
* CHEMSPIDER:
−
{{#set: common name=Aconitase/3-isopropylmalate dehydratase, swivel}}
+
** [http://www.chemspider.com/Chemical-Structure.553829.html 553829]
−
{{#set: gene associated=Ec-16_001000|Ec-12_000170}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5913|PWY-6969|PWY-6549|PWY-5392|TCA|P23-PWY|P105-PWY|GLYOXYLATE-BYPASS|FERMENTATION-PWY|PWY-6728|REDCITCYC|PWY-7254|PWY-7124|PWY66-398|PWY-5690}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=310312 310312]
−
{{#set: reconstruction category=annotation}}
+
* METABOLIGHTS : MTBLC310312
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2)}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=DXDRHHKMWQZJHT-FPYGCLRLSA-N}}
 +
{{#set: common name=isoliquiritigenin}}
 +
{{#set: molecular weight=256.257    }}
 +
{{#set: common name=42'4'-trihydroxychalcone}}
 +
{{#set: consumed by=RXN-3221}}
 +
{{#set: produced by=RXN-3142}}

Revision as of 21:01, 17 March 2018

Metabolite CPD-3041

  • smiles:
    • C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2)
  • inchi key:
    • InChIKey=DXDRHHKMWQZJHT-FPYGCLRLSA-N
  • common name:
    • isoliquiritigenin
  • molecular weight:
    • 256.257
  • Synonym(s):
    • 42'4'-trihydroxychalcone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • DRUGBANK : DB03285
  • PUBCHEM:
  • HMDB : HMDB37316
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • METABOLIGHTS : MTBLC310312




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=P321-PWY&oldid=11310"