Difference between revisions of "RXN-15346"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYISOVALDEHYDRAT-RXN DIHYDROXYISOVALDEHYDRAT-RXN] == * direction: ** LEFT-TO-RIGHT * common...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYISOVALDEHYDRAT-RXN DIHYDROXYISOVALDEHYDRAT-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Dihydroxy-acid/6-phosphogluconate dehydratase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.9 EC-4.2.1.9] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-13357]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[2-KETO-ISOVALERATE]][c] |
− | = | + | * With common name(s): |
+ | ** 1 (2R)-2,3-dihydroxy-3-methylbutanoate[c] '''=>''' 1 H2O[c] '''+''' 1 3-methyl-2-oxobutanoate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-03_000220]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways == | ||
+ | * [[VALSYN-PWY]], L-valine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=VALSYN-PWY VALSYN-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-7111]], pyruvate fermentation to isobutanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7111 PWY-7111] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04441 R04441] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P55186 P55186] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JUE0 Q9JUE0] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P05791 P05791] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9UZ03 Q9UZ03] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P44851 P44851] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q02139 Q02139] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PJ98 Q9PJ98] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P39522 P39522] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=Dihydroxy-acid/6-phosphogluconate dehydratase}} |
− | {{#set: | + | {{#set: ec number=EC-4.2.1.9}} |
− | {{#set: | + | {{#set: gene associated=Ec-03_000220}} |
− | {{#set: | + | {{#set: in pathway=VALSYN-PWY|PWY-7111}} |
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 21:02, 17 March 2018
Contents
Reaction DIHYDROXYISOVALDEHYDRAT-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Dihydroxy-acid/6-phosphogluconate dehydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-13357[c] => 1 WATER[c] + 1 2-KETO-ISOVALERATE[c]
- With common name(s):
- 1 (2R)-2,3-dihydroxy-3-methylbutanoate[c] => 1 H2O[c] + 1 3-methyl-2-oxobutanoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-03_000220
- ESILICULOSUS_GENOME
- EC-NUMBER
- pantograph-aragem
- ESILICULOSUS_GENOME
Pathways
- VALSYN-PWY, L-valine biosynthesis: VALSYN-PWY
- 4 reactions found over 4 reactions in the full pathway
- PWY-7111, pyruvate fermentation to isobutanol (engineered): PWY-7111
- 3 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links