Difference between revisions of "RXN-9003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14196 RXN-14196] == * direction: ** LEFT-TO-RIGHT * common name: ** carbamoyl-phosphate synthas...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14196 RXN-14196] ==
−
* smiles:
+
* direction:
−
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
+
 
* common name:
 
* common name:
−
** GDP-β-L-fucose
+
** carbamoyl-phosphate synthase (glutamine-hydrolyzing)
−
* molecular weight:
+
* ec number:
−
** 587.33   
+
** [http://enzyme.expasy.org/EC/2.7.2 EC-2.7.2]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[1.1.1.271-RXN]]
+
** 1 [[CARBAMATE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[CARBAMOYL-P]][c] '''+''' 1 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[2.4.1.221-RXN]]
+
** 1 carbamate[c] '''+''' 1 ATP[c] '''=>''' 1 carbamoyl phosphate[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-10_006110]]
 +
** ESILICULOSUS_GENOME
 +
***GO-TERM
 +
== Pathways  ==
 +
* [[PWY-7693]], guadinomine B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7693 PWY-7693]
 +
** '''3''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30758 30758]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01395 R01395]
−
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
+
{{#set: common name=carbamoyl-phosphate synthase (glutamine-hydrolyzing)}}
−
{{#set: common name=GDP-β-L-fucose}}
+
{{#set: ec number=EC-2.7.2}}
−
{{#set: molecular weight=587.33    }}
+
{{#set: gene associated=Ec-10_006110}}
−
{{#set: produced by=1.1.1.271-RXN}}
+
{{#set: in pathway=PWY-7693}}
−
{{#set: consumed or produced by=2.4.1.221-RXN}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 21:02, 17 March 2018

Reaction RXN-14196

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • carbamoyl-phosphate synthase (glutamine-hydrolyzing)
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 carbamate[c] + 1 ATP[c] => 1 carbamoyl phosphate[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7693, guadinomine B biosynthesis: PWY-7693
    • 3 reactions found over 12 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9003&oldid=11342"