Difference between revisions of "CPD-332"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-23_002490 == * left end position: ** 2592008 * transcription direction: ** POSITIVE * right end position: ** 2599405 * centisome position: ** 53.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_002490 == |
− | * | + | * left end position: |
− | ** | + | ** 2592008 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2599405 |
− | * | + | * centisome position: |
− | ** | + | ** 53.55978 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0132_0050 |
+ | ** Esi0132_0050 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[LYSOPHOSPHOLIPASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | * [[RXN- | + | ***automated-name-match |
− | == | + | * [[RXN-15035]] |
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7409]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2592008}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2599405}} | |
− | + | {{#set: centisome position=53.55978 }} | |
− | + | {{#set: common name=Esi_0132_0050|Esi0132_0050}} | |
− | + | {{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}} | |
− | + | {{#set: pathway associated=PWY-7409}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:02, 17 March 2018
Gene Ec-23_002490
- left end position:
- 2592008
- transcription direction:
- POSITIVE
- right end position:
- 2599405
- centisome position:
- 53.55978
- Synonym(s):
- Esi_0132_0050
- Esi0132_0050
Reactions associated
- LYSOPHOSPHOLIPASE-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-15035
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome