Difference between revisions of "PWY-7723"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Gene == Gene Ec-07_007020 == * left end position: ** 6721223 * transcription direction: ** NEGATIVE * right end position: ** 6728877 * centisome position: ** 87.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_007020 == |
− | * | + | * left end position: |
− | ** | + | ** 6721223 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6728877 |
− | * | + | * centisome position: |
− | ** | + | ** 87.03508 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0111_0044 |
− | ** | + | ** Esi0111_0044 |
− | ** | + | ** DPAGT1 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.7.8.15-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | * [[ | + | * [[PHOSNACMURPENTATRANS-RXN]] |
− | * [[ | + | ** esiliculosus_genome |
− | * [[ | + | ***go-term |
+ | * [[RXN-11347]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-8975]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6470]] | ||
+ | * [[PWY-6471]] | ||
+ | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]] | ||
+ | * [[PEPTIDOGLYCANSYN-PWY]] | ||
+ | * [[PWY-5265]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6721223}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6728877}} | |
− | + | {{#set: centisome position=87.03508 }} | |
− | + | {{#set: common name=Esi_0111_0044|Esi0111_0044|DPAGT1}} | |
− | + | {{#set: reaction associated=2.7.8.15-RXN|PHOSNACMURPENTATRANS-RXN|RXN-11347|RXN-8975}} | |
− | + | {{#set: pathway associated=PWY-6470|PWY-6471|MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS|PEPTIDOGLYCANSYN-PWY|PWY-5265}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:02, 17 March 2018
Gene Ec-07_007020
- left end position:
- 6721223
- transcription direction:
- NEGATIVE
- right end position:
- 6728877
- centisome position:
- 87.03508
- Synonym(s):
- Esi_0111_0044
- Esi0111_0044
- DPAGT1
Reactions associated
- 2.7.8.15-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome
- PHOSNACMURPENTATRANS-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-11347
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-8975
- esiliculosus_genome
- go-term
- esiliculosus_genome