Difference between revisions of "RXN-14117"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-15_001370 == * left end position: ** 1616676 * transcription direction: ** NEGATIVE * right end position: ** 1622666 * centisome position: ** 29.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J |
| − | * | + | * common name: |
| − | ** | + | ** dATP |
| − | * | + | * molecular weight: |
| − | ** | + | ** 487.152 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-deoxyATP |
| − | ** | + | ** 2'-deoxyadenosine triphosphate |
| + | ** deoxy-ATP | ||
| + | ** deoxyadenosine-triphosphate | ||
| + | ** 2'-deoxyadenosine-5'-triphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14195]] |
| − | + | * [[RXN-14214]] | |
| − | + | * [[RXN-14290]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[DADPKIN-RXN]] | |
| − | + | * [[RXN0-745]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | * [[RXN-14192]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 1927-31-7 |
| − | {{#set: | + | * BIGG : 33969 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25320183 25320183] |
| − | {{#set: common name= | + | * HMDB : HMDB01532 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00131 C00131] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61404 61404] | ||
| + | * METABOLIGHTS : MTBLC61404 | ||
| + | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J}} | ||
| + | {{#set: common name=dATP}} | ||
| + | {{#set: molecular weight=487.152 }} | ||
| + | {{#set: common name=2'-deoxyATP|2'-deoxyadenosine triphosphate|deoxy-ATP|deoxyadenosine-triphosphate|2'-deoxyadenosine-5'-triphosphate}} | ||
| + | {{#set: consumed by=RXN-14195|RXN-14214|RXN-14290}} | ||
| + | {{#set: produced by=DADPKIN-RXN|RXN0-745}} | ||
| + | {{#set: reversible reaction associated=RXN-14192}} | ||
Revision as of 21:03, 17 March 2018
Contents
Metabolite DATP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- inchi key:
- InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J
- common name:
- dATP
- molecular weight:
- 487.152
- Synonym(s):
- 2'-deoxyATP
- 2'-deoxyadenosine triphosphate
- deoxy-ATP
- deoxyadenosine-triphosphate
- 2'-deoxyadenosine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1927-31-7
- BIGG : 33969
- PUBCHEM:
- HMDB : HMDB01532
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61404
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
