Difference between revisions of "PWY-7769"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_007870 == * left end position: ** 5533858 * transcription direction: ** POSITIVE * right end position: ** 5545396 * centisome position: ** 63.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == * smiles: ** CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L |
− | * | + | * common name: |
− | ** | + | ** 2-C-methyl-D-erythritol-2,4-cyclodiphosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 276.076 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ME-2,4cPP |
− | + | ||
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-882]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN0-302]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21605869 21605869] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10241147.html 10241147] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58483 58483] |
+ | * BIGG : 216364 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11453 C11453] | ||
+ | {{#set: smiles=CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L}} | ||
+ | {{#set: common name=2-C-methyl-D-erythritol-2,4-cyclodiphosphate}} | ||
+ | {{#set: molecular weight=276.076 }} | ||
+ | {{#set: common name=ME-2,4cPP}} | ||
+ | {{#set: consumed by=RXN0-882}} | ||
+ | {{#set: produced by=RXN0-302}} |
Revision as of 21:04, 17 March 2018
Contents
Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE
- smiles:
- CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)
- inchi key:
- InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L
- common name:
- 2-C-methyl-D-erythritol-2,4-cyclodiphosphate
- molecular weight:
- 276.076
- Synonym(s):
- ME-2,4cPP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)" cannot be used as a page name in this wiki.