Difference between revisions of "CPD-10284"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCV3 TCV3] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With identifiers:...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCV3 TCV3] ==
* smiles:
+
* direction:
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
+
** REVERSIBLE
* inchi key:
+
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
+
* common name:
+
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
+
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-14]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NITRATE]][c] '''<=>''' 1.0 [[NITRATE]][v]
* [[RXN66-13]]
+
* With common name(s):
* [[RXN-13707]]
+
** 1.0 nitrate[c] '''<=>''' 1.0 nitrate[v]
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-19_004150]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-19_004180]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-19_004160]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-19_004130]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-19_004170]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200473 25200473]
+
{{#set: gene associated=Ec-19_004150|Ec-19_004180|Ec-19_004160|Ec-19_004130|Ec-19_004170}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=4,4-dimethyl-5-&alpha;-cholesta-8,14-dien-3-&beta;-ol}}
+
{{#set: reconstruction source=orthology-aragem}}
{{#set: molecular weight=412.698    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: consumed by=RXN66-14}}
+
{{#set: produced by=RXN66-13|RXN-13707}}
+

Revision as of 21:05, 17 March 2018

Reaction TCV3

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 nitrate[c] <=> 1.0 nitrate[v]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links