Difference between revisions of "PWY-5691"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Gene == Gene Ec-12_000850 == * left end position: ** 812698 * transcription direction: ** POSITIVE * right end position: ** 816055 * centisome position: ** 9.7491...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_000850 == |
− | * | + | * left end position: |
− | ** | + | ** 812698 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 816055 |
− | * | + | * centisome position: |
− | ** | + | ** 9.749196 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0193_0026 |
− | ** | + | ** Esi0193_0026 |
− | ** | + | ** HIS8 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[HISTAMINOTRANS-RXN]] |
− | * | + | ** esiliculosus_genome |
− | + | ***ec-number | |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | + | * [[PHEAMINOTRANS-RXN]] | |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-5079]] |
− | + | * [[PWY-7432]] | |
− | * [[ | + | * [[ANAPHENOXI-PWY]] |
− | * [[ | + | * [[HISTSYN-PWY]] |
− | * [[ | + | * [[PHESYN]] |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=812698}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=816055}} | |
− | + | {{#set: centisome position=9.749196 }} | |
− | + | {{#set: common name=Esi_0193_0026|Esi0193_0026|HIS8}} | |
− | + | {{#set: reaction associated=HISTAMINOTRANS-RXN|PHEAMINOTRANS-RXN}} | |
− | + | {{#set: pathway associated=PWY-5079|PWY-7432|ANAPHENOXI-PWY|HISTSYN-PWY|PHESYN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 21:05, 17 March 2018
Gene Ec-12_000850
- left end position:
- 812698
- transcription direction:
- POSITIVE
- right end position:
- 816055
- centisome position:
- 9.749196
- Synonym(s):
- Esi_0193_0026
- Esi0193_0026
- HIS8
Reactions associated
- HISTAMINOTRANS-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome
- PHEAMINOTRANS-RXN