Difference between revisions of "PWY-5751"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] == * common name: ** R'C(R)SH * Synonym(s): ** a sulfhydryls == React...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** R'C(R)SH |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a sulfhydryls |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[THIOL-OXIDASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=R'C(R)SH}} | |
− | + | {{#set: common name=a sulfhydryls}} | |
− | + | {{#set: consumed by=THIOL-OXIDASE-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 21:07, 17 March 2018
Contents
Metabolite Sulfhydryls
- common name:
- R'C(R)SH
- Synonym(s):
- a sulfhydryls