Difference between revisions of "PWY-5751"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] == * common name: ** R'C(R)SH * Synonym(s): ** a sulfhydryls == React...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] ==
* smiles:
+
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
+
 
* common name:
 
* common name:
** aldehydo-D-glucuronate
+
** R'C(R)SH
* molecular weight:
+
** 193.133   
+
 
* Synonym(s):
 
* Synonym(s):
** aldehydo-D-glucuronic acid
+
** a sulfhydryls
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[THIOL-OXIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14693]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=R'C(R)SH}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126]
+
{{#set: common name=a sulfhydryls}}
* CHEBI:
+
{{#set: consumed by=THIOL-OXIDASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953]
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}}
+
{{#set: common name=aldehydo-D-glucuronate}}
+
{{#set: molecular weight=193.133    }}
+
{{#set: common name=aldehydo-D-glucuronic acid}}
+
{{#set: consumed or produced by=RXN-14693}}
+

Revision as of 21:07, 17 March 2018

Metabolite Sulfhydryls

  • common name:
    • R'C(R)SH
  • Synonym(s):
    • a sulfhydryls

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links