|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FUMHYDR-RXN FUMHYDR-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| + | * inchi key: |
| + | ** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J |
| * common name: | | * common name: |
− | ** Fumarate lyase, N-terminal | + | ** (5Z)-tetradecenoyl-CoA |
− | ** fumarate hydratase | + | * molecular weight: |
− | * ec number:
| + | ** 971.845 |
− | ** [http://enzyme.expasy.org/EC/4.2.1.2 EC-4.2.1.2] | + | |
| * Synonym(s): | | * Synonym(s): |
− | ** fumarate hydration | + | ** cis-tetradec-5-enoyl-CoA |
− | ** malate dehydration | + | ** 14:1 cis-5 |
| + | ** 14:1(n-9) |
| + | ** (5Z)-tetradec-5-enoyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-14576]] |
− | ** 1 [[MAL]][c] '''<=>''' 1 [[WATER]][c] '''+''' 1 [[FUM]][c]
| + | * [[RXN-17783]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 1 (S)-malate[c] '''<=>''' 1 H2O[c] '''+''' 1 fumarate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-23_003460]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-25_001360]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | == Pathways ==
| + | |
− | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| + | |
− | ** '''8''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-561]], superpathway of glyoxylate cycle and fatty acid degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561]
| + | |
− | ** '''6''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[P42-PWY]], incomplete reductive TCA cycle: [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY] | + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7384]], anaerobic energy metabolism (invertebrates, mitochondrial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384] | + | |
− | ** '''6''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-5392]], reductive TCA cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392]
| + | |
− | ** '''6''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
| + | |
− | ** '''11''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[REDCITCYC]], TCA cycle VIII (helicobacter): [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254]
| + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[P108-PWY]], pyruvate fermentation to propanoate I: [http://metacyc.org/META/NEW-IMAGE?object=P108-PWY P108-PWY]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
| + | |
− | ** '''9''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
| + | |
− | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[aragem]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12460 12460] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071] |
− | * PIR:
| + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A47692 A47692]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A49760 A49760] | + | {{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A64377 A64377] | + | {{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A81281 A81281]
| + | {{#set: common name=(5Z)-tetradecenoyl-CoA}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A81807 A81807]
| + | {{#set: molecular weight=971.845 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B44511 B44511]
| + | {{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B81862 B81862]
| + | {{#set: consumed by=RXN-14576|RXN-17783}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E64461 E64461]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E64685 E64685]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H70896 H70896]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H71462 H71462]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JC4293 JC4293]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JC4982 JC4982]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PA0062 PA0062]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S40448 S40448]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S76348 S76348]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T00433 T00433]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07374 T07374]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T41265 T41265]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T43727 T43727]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T45269 T45269]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=UFBSC8 UFBSC8]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=UFBYM UFBYM]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=UFEC UFEC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=UFECAQ UFECAQ]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=UFHUM UFHUM]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=UFPG UFPG]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=UFRT UFRT]
| + | |
− | * LIGAND-RXN:
| + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01082 R01082]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04718 Q04718]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58034 Q58034]
| + | |
− | ** [http://www.uniprot.org/uniprot/O69294 O69294]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTE3 Q9JTE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14407 P14407]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTR0 Q9JTR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58690 Q58690]
| + | |
− | ** [http://www.uniprot.org/uniprot/O25883 O25883]
| + | |
− | ** [http://www.uniprot.org/uniprot/O53446 O53446]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84863 O84863]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q51404 Q51404]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4Z3 Q7M4Z3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39461 P39461]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55674 Q55674]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93033 P93033]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43180 Q43180]
| + | |
− | ** [http://www.uniprot.org/uniprot/O94552 O94552]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66271 O66271]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60022 Q60022]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07343 P07343]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08417 P08417]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05042 P05042]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AC33 P0AC33]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10173 P10173]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14408 P14408]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=Fumarate lyase, N-terminal}} | + | |
− | {{#set: common name=fumarate hydratase}} | + | |
− | {{#set: ec number=EC-4.2.1.2}} | + | |
− | {{#set: common name=fumarate hydration|malate dehydration}} | + | |
− | {{#set: gene associated=Ec-23_003460|Ec-25_001360}}
| + | |
− | {{#set: in pathway=FERMENTATION-PWY|PWY-561|PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|P105-PWY|PWY-6969|PWY-6728|REDCITCYC|PWY-7254|P108-PWY|TCA|PWY66-398|PWY-5690}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=aragem}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |