Difference between revisions of "CPD-14928"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9463 RXN-9463] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-1,2-fucosyltransferase,...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9463 RXN-9463] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
+
 
* common name:
 
* common name:
−
** phytenoyl-CoA
+
** alpha-1,2-fucosyltransferase, putative
−
* molecular weight:
+
* ec number:
−
** 1056.006   
+
** [http://enzyme.expasy.org/EC/2.4.1 EC-2.4.1]
 
* Synonym(s):
 
* Synonym(s):
−
** E-phytenoyl-CoA
 
−
** trans-phytenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-482]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Xyloglucans-Galactose-23]][c] '''+''' 1 [[GUANOSINE_DIPHOSPHATE_FUCOSE]][c] '''=>''' 1 [[GDP]][c] '''+''' 1 [[XLFG-Xyloglucans]][c] '''+''' 1 [[PROTON]][c]
−
* [[RXN66-480]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 an XLLG xylogulcan[c] '''+''' 1 GDP-L-fucose[c] '''=>''' 1 GDP[c] '''+''' 1 an XLFG xylogulcan[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-22_001510]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5936]], xyloglucan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5936 PWY-5936]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
+
{{#set: common name=alpha-1,2-fucosyltransferase, putative}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: ec number=EC-2.4.1}}
−
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
+
{{#set: gene associated=Ec-22_001510}}
−
{{#set: common name=phytenoyl-CoA}}
+
{{#set: in pathway=PWY-5936}}
−
{{#set: molecular weight=1056.006    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: consumed by=RXN66-482}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: produced by=RXN66-480}}
+

Revision as of 21:09, 17 March 2018

Reaction RXN-9463

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alpha-1,2-fucosyltransferase, putative
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5936, xyloglucan biosynthesis: PWY-5936
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-14928&oldid=11843"