|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSGLYPHOS-RXN PHOSGLYPHOS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)([O-])=O)[N+] |
| + | * inchi key: |
| + | ** InChIKey=WVIMUEUQJFPNDK-PEBGCTIMSA-M |
| * common name: | | * common name: |
− | ** Phosphoglycerate kinase, C-terminal | + | ** CDP-ethanolamine |
− | ** phosphoglycerate kinase | + | * molecular weight: |
− | ** Phosphoglycerate kinase
| + | ** 445.239 |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/2.7.2.3 EC-2.7.2.3] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** cytidine diphosphate ethanolamine |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] |
− | ** 1 [[G3P]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[DPG]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[2.7.7.14-RXN]] |
− | ** 1 3-phospho-D-glycerate[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 1,3-bisphospho-D-glycerate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-12_004530]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-08_002400]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-21_004220]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | * [[Ec-01_001350]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-21_005710]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-12_004550]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY]
| + | |
− | ** '''11''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS] | + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6901]], superpathway of glucose and xylose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6901 PWY-6901]
| + | |
− | ** '''9''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[SUCSYN-PWY]], sucrose biosynthesis I (from photosynthesis): [http://metacyc.org/META/NEW-IMAGE?object=SUCSYN-PWY SUCSYN-PWY]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''12''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[PWY-6886]], 1-butanol autotrophic biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6886 PWY-6886]
| + | |
− | ** '''8''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
| + | |
− | ** '''11''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-7003]], glycerol degradation to butanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| + | |
− | ** '''13''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[aragem]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 3036-18-8 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14801 14801] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202847 25202847] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01512 R01512] | + | * HMDB : HMDB01564 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P11977 P11977] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00570 C00570] |
− | ** [http://www.uniprot.org/uniprot/P09411 P09411]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P09041 P09041]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57876 57876] |
− | ** [http://www.uniprot.org/uniprot/P07205 P07205] | + | * METABOLIGHTS : MTBLC57876 |
− | ** [http://www.uniprot.org/uniprot/P16617 P16617]
| + | {{#set: smiles=C(COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)([O-])=O)[N+]}} |
− | ** [http://www.uniprot.org/uniprot/Q37743 Q37743]
| + | {{#set: inchi key=InChIKey=WVIMUEUQJFPNDK-PEBGCTIMSA-M}} |
− | ** [http://www.uniprot.org/uniprot/Q58058 Q58058]
| + | {{#set: common name=CDP-ethanolamine}} |
− | ** [http://www.uniprot.org/uniprot/P56154 P56154]
| + | {{#set: molecular weight=445.239 }} |
− | ** [http://www.uniprot.org/uniprot/O29119 O29119]
| + | {{#set: common name=cytidine diphosphate ethanolamine}} |
− | ** [http://www.uniprot.org/uniprot/Q01655 Q01655]
| + | {{#set: consumed by=ETHANOLAMINEPHOSPHOTRANSFERASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q9URB3 Q9URB3]
| + | {{#set: produced by=2.7.7.14-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P47542 P47542]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27121 O27121]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PMQ5 Q9PMQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40924 P40924]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43726 P43726]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66519 O66519]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JWS8 Q9JWS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CIW1 Q9CIW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36204 P36204]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59181 Q59181]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50319 P50319]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50310 P50310]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51903 P51903]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18912 P18912]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41757 P41757]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27362 P27362]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24269 P24269]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00560 P00560]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25055 P25055]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01604 Q01604]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00558 P00558]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07377 P07377]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07378 P07378]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14828 P14828]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09404 P09404]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29408 P29408]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20972 P20972]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20971 P20971]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24590 P24590]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29409 P29409]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33161 P33161]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29405 P29405]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50317 P50317]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50315 P50315]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29407 P29407]
| + | |
− | ** [http://www.uniprot.org/uniprot/P61884 P61884]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42542 Q42542]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50318 P50318]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46712 P46712]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78018 P78018]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49073 Q49073]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42961 Q42961]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42962 Q42962]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81394 O81394]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41758 P41758]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32756 O32756]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38667 P38667]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08966 P08966]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08967 P08967]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A799 P0A799]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09188 P09188]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14228 P14228]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08891 P08891]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08892 P08892]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08893 P08893]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12782 P12782]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12783 P12783]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=Phosphoglycerate kinase, C-terminal}}
| + | |
− | {{#set: common name=phosphoglycerate kinase}}
| + | |
− | {{#set: common name=Phosphoglycerate kinase}}
| + | |
− | {{#set: ec number=EC-2.7.2.3}}
| + | |
− | {{#set: gene associated=Ec-12_004530|Ec-08_002400|Ec-21_004220|Ec-01_001350|Ec-21_005710|Ec-12_004550}} | + | |
− | {{#set: in pathway=PWY-1042|P185-PWY|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|SUCSYN-PWY|P124-PWY|PWY-6886|CALVIN-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|PWY-7003|P122-PWY|PWY66-399}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=aragem}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |