Difference between revisions of "Ec-21 003740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=YYGNTYWPHWGJRM-AAJYLUCBSA-N
+
 
* common name:
 
* common name:
−
** squalene
+
** jasmonic acid biosynthesis
−
* molecular weight:
+
−
** 410.725   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** jasmonate biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[SQUALENE-MONOOXYGENASE-RXN]]
+
'''10''' reactions found over '''19''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-10696]]
−
* [[RXN-13724]]
+
** 3 associated gene(s):
−
* [[RXN66-281]]
+
*** [[Ec-22_002920]]
−
* [[RXN-13162]]
+
*** [[Ec-08_006390]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-26_004320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10697]]
 +
** 4 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-16_003560]]
 +
*** [[Ec-06_001380]]
 +
*** [[Ec-16_001250]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10698]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-19_005290]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10702]]
 +
** 2 associated gene(s):
 +
*** [[Ec-19_005290]]
 +
*** [[Ec-14_006530]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10703]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-19_005290]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10704]]
 +
** 4 associated gene(s):
 +
*** [[Ec-06_001380]]
 +
*** [[Ec-16_001250]]
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-16_003560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10705]]
 +
** 4 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-16_001250]]
 +
*** [[Ec-16_003560]]
 +
*** [[Ec-06_001380]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10706]]
 +
** 3 associated gene(s):
 +
*** [[Ec-26_004320]]
 +
*** [[Ec-08_006390]]
 +
*** [[Ec-22_002920]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10707]]
 +
** 3 associated gene(s):
 +
*** [[Ec-08_006390]]
 +
*** [[Ec-26_004320]]
 +
*** [[Ec-22_002920]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-1321]]
 +
** 4 associated gene(s):
 +
*** [[Ec-20_003620]]
 +
*** [[Ec-03_000020]]
 +
*** [[Ec-03_000010]]
 +
*** [[Ec-20_003630]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=12-OXOPHYTODIENOATE-REDUCTASE-RXN 12-OXOPHYTODIENOATE-REDUCTASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ALLENE-OXIDE-CYCLASE-RXN ALLENE-OXIDE-CYCLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10695 RXN-10695]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10699 RXN-10699]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10700 RXN-10700]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10701 RXN-10701]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10708 RXN-10708]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-745 RXN-745]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-19 RXN1F-19]
 
== External links  ==
 
== External links  ==
−
* CAS : 111-02-4
+
* ARACYC:
−
* LIPID_MAPS : LMPR0106010002
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-735 PWY-735]
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=638072 638072]
+
{{#set: common name=jasmonic acid biosynthesis}}
−
* HMDB : HMDB00256
+
{{#set: common name=jasmonate biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=10}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00751 C00751]
+
{{#set: total reaction=19}}
−
* CHEBI:
+
{{#set: completion rate=53.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15440 15440]
+
−
* METABOLIGHTS : MTBLC15440
+
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C}}
+
−
{{#set: inchi key=InChIKey=YYGNTYWPHWGJRM-AAJYLUCBSA-N}}
+
−
{{#set: common name=squalene}}
+
−
{{#set: molecular weight=410.725    }}
+
−
{{#set: consumed by=SQUALENE-MONOOXYGENASE-RXN}}
+
−
{{#set: produced by=RXN-13724|RXN66-281|RXN-13162}}
+

Revision as of 21:10, 17 March 2018

Pathway PWY-735

  • taxonomic range:
  • common name:
    • jasmonic acid biosynthesis
  • Synonym(s):
    • jasmonate biosynthesis

Reaction(s) found

10 reactions found over 19 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_003740&oldid=11891"