Difference between revisions of "PWY-6608"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-26_001830 == * left end position: ** 2292144 * transcription direction: ** POSITIVE * right end position: ** 2298796 * centisome position: ** 34.8...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-26_001830 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
* left end position:
+
* smiles:
** 2292144
+
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
* right end position:
+
* common name:
** 2298796
+
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
* centisome position:
+
* molecular weight:
** 34.8173    
+
** 959.791    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0077_0097
+
** (S)-3-hydroxy-12:1-Δ5-CoA
** Esi0077_0097
+
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
+
* [[RXN-17798]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-17797]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7765]]
+
* [[PWY-5651]]
+
* [[PWY-6309]]
+
* [[PWY-7717]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2292144}}
+
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
{{#set: right end position=2298796}}
+
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
{{#set: centisome position=34.8173   }}
+
{{#set: molecular weight=959.791   }}
{{#set: common name=Esi_0077_0097|Esi0077_0097}}
+
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
{{#set: reaction associated=KYNURENINE-3-MONOOXYGENASE-RXN}}
+
{{#set: consumed by=RXN-17798}}
{{#set: pathway associated=PWY-7765|PWY-5651|PWY-6309|PWY-7717}}
+
{{#set: produced by=RXN-17797}}

Revision as of 21:10, 17 March 2018

Metabolite CPD-19151

  • smiles:
    • CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
  • common name:
    • (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
  • molecular weight:
    • 959.791
  • Synonym(s):
    • (S)-3-hydroxy-12:1-Δ5-CoA
    • (S)-3-hydroxy-5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.