Difference between revisions of "RXN-4144"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Gene == Gene Ec-27_004240 == * left end position: ** 3721120 * transcription direction: ** POSITIVE * right end position: ** 3722358 * centisome position: ** 57.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_004240 == |
− | * | + | * left end position: |
− | ** | + | ** 3721120 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3722358 |
− | * | + | * centisome position: |
− | ** | + | ** 57.692616 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0000_0403 | ||
+ | ** Esi0000_0403 | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN0-1061]] | |
− | * [[ | + | ** esiliculosus_genome |
− | * | + | ***automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=3721120}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3722358}} | |
− | + | {{#set: centisome position=57.692616 }} | |
− | + | {{#set: common name=Esi_0000_0403|Esi0000_0403}} | |
− | + | {{#set: reaction associated=RXN0-1061}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:10, 17 March 2018
Gene Ec-27_004240
- left end position:
- 3721120
- transcription direction:
- POSITIVE
- right end position:
- 3722358
- centisome position:
- 57.692616
- Synonym(s):
- Esi_0000_0403
- Esi0000_0403
Reactions associated
- RXN0-1061
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome