Difference between revisions of "Ec-03 004940"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == * smiles: ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C...")
 
(Created page with "Category:Gene == Gene Ec-24_002450 == * left end position: ** 2770490 * transcription direction: ** POSITIVE * right end position: ** 2777462 * centisome position: ** 55.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] ==
+
== Gene Ec-24_002450 ==
−
* smiles:
+
* left end position:
−
** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]
+
** 2770490
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E
+
** POSITIVE
−
* common name:
+
* right end position:
−
** cobalt-precorrin-2
+
** 2777462
−
* molecular weight:
+
* centisome position:
−
** 912.701    
+
** 55.546753    
 
* Synonym(s):
 
* Synonym(s):
−
** cobalt-dihydrosirohydrochlorin
+
** Esi_0060_0121
 +
** Esi0060_0121
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[CARBOXYPEPTIDASE-A-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-8759]]
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2770490}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820486 91820486]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2777462}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3790 3790]
+
{{#set: centisome position=55.546753   }}
−
{{#set: smiles=CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]}}
+
{{#set: common name=Esi_0060_0121|Esi0060_0121}}
−
{{#set: inchi key=InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E}}
+
{{#set: reaction associated=CARBOXYPEPTIDASE-A-RXN}}
−
{{#set: common name=cobalt-precorrin-2}}
+
−
{{#set: molecular weight=912.701   }}
+
−
{{#set: common name=cobalt-dihydrosirohydrochlorin}}
+
−
{{#set: consumed or produced by=RXN-8759}}
+

Revision as of 22:10, 17 March 2018

Gene Ec-24_002450

  • left end position:
    • 2770490
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2777462
  • centisome position:
    • 55.546753
  • Synonym(s):
    • Esi_0060_0121
    • Esi0060_0121

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_004940&oldid=11940"