Difference between revisions of "RXN-17111"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-01_005220 == * left end position: ** 4497052 * transcription direction: ** POSITIVE * right end position: ** 4501486 * centisome position: ** 43.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_005220 == |
− | * | + | * left end position: |
− | ** | + | ** 4497052 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4501486 |
− | * | + | * centisome position: |
− | ** | + | ** 43.58101 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0018_0080 |
− | ** | + | ** Esi0018_0080 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RIBOKIN-RXN]] |
− | * | + | ** esiliculosus_genome |
− | * [[RXN- | + | ***go-term |
− | * | + | * [[RXN-14223]] |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***go-term |
− | + | == Pathways associated == | |
+ | * [[RIBOKIN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4497052}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4501486}} | |
− | + | {{#set: centisome position=43.58101 }} | |
− | + | {{#set: common name=Esi_0018_0080|Esi0018_0080}} | |
− | + | {{#set: reaction associated=RIBOKIN-RXN|RXN-14223}} | |
− | + | {{#set: pathway associated=RIBOKIN-PWY}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:12, 17 March 2018
Gene Ec-01_005220
- left end position:
- 4497052
- transcription direction:
- POSITIVE
- right end position:
- 4501486
- centisome position:
- 43.58101
- Synonym(s):
- Esi_0018_0080
- Esi0018_0080
Reactions associated
- RIBOKIN-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-14223
- esiliculosus_genome
- go-term
- esiliculosus_genome