Difference between revisions of "RXN-14325"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE D-RIBULOSE] == * smiles: ** C(O)C(O)C(O)C(=O)CO * inchi key: ** InChIKey=ZAQJHHRNXZU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == |
* smiles: | * smiles: | ||
| − | ** C(O)C(O)C(O)C(=O) | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 18-hydroxyoleoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1043.952 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (9Z)-18-hydroxyoctadec-9-enoyl-CoA |
| − | + | ** ω-hydroxyoleoyl-CoA | |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16117]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16402]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044] |
| − | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | {{#set: smiles=C(O)C(O)C(O)C(=O) | + | {{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=18-hydroxyoleoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: molecular weight=1043.952 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|ω-hydroxyoleoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-16117}} |
| − | {{#set: consumed | + | {{#set: produced by=RXN-16402}} |
Revision as of 21:13, 17 March 2018
Contents
Metabolite CPD-17370
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
- common name:
- 18-hydroxyoleoyl-CoA
- molecular weight:
- 1043.952
- Synonym(s):
- (9Z)-18-hydroxyoctadec-9-enoyl-CoA
- ω-hydroxyoleoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
