Difference between revisions of "Myristoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9140 RXN-9140] == * direction: ** LEFT-TO-RIGHT * common name: ** Similar to 2-Epi-5-Epi-Valiol...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9140 RXN-9140] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NC(CCSC)C([O-])=O
 +
* inchi key:
 +
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
 
* common name:
 
* common name:
−
** Similar to 2-Epi-5-Epi-Valiolone Synthase (Sedoheptulose 7-Phosphate Cyclase)
+
** N-α-acetyl-L-methionine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.2.3.152 EC-4.2.3.152]
+
** 190.237   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-L-methionine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[D-SEDOHEPTULOSE-7-P]][c] '''=>''' 1 [[CPD-9663]][c] '''+''' 1 [[Pi]][c]
+
* [[RXN0-6948]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 D-sedoheptulose 7-phosphate[c] '''=>''' 1 2-epi-5-epi-valiolone[c] '''+''' 1 phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-06_009700]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5818]], validamycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5818 PWY-5818]
+
−
** '''1''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWY-7752]], gadusol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7752 PWY-7752]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB01646
−
{{#set: common name=Similar to 2-Epi-5-Epi-Valiolone Synthase (Sedoheptulose 7-Phosphate Cyclase)}}
+
* PUBCHEM:
−
{{#set: ec number=EC-4.2.3.152}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
−
{{#set: gene associated=Ec-06_009700}}
+
* HMDB : HMDB11745
−
{{#set: in pathway=PWY-5818|PWY-7752}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=esiliculosus_genome}}
+
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
 +
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
 +
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
 +
{{#set: common name=N-α-acetyl-L-methionine}}
 +
{{#set: molecular weight=190.237    }}
 +
{{#set: common name=N-acetyl-L-methionine}}
 +
{{#set: produced by=RXN0-6948}}

Revision as of 21:13, 17 March 2018

Metabolite CPD0-2015

  • smiles:
    • CC(=O)NC(CCSC)C([O-])=O
  • inchi key:
    • InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
  • common name:
    • N-α-acetyl-L-methionine
  • molecular weight:
    • 190.237
  • Synonym(s):
    • N-acetyl-L-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC(CCSC)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Myristoyl-ACPs&oldid=12119"