Difference between revisions of "Ec-25 000050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7173 PWY-7173] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
+
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
 +
* inchi key:
 +
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
 
* common name:
 
* common name:
−
** quercetin triglucoside biosynthesis
+
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
 +
* molecular weight:
 +
** 185.136   
 
* Synonym(s):
 
* Synonym(s):
 +
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-14014]]
−
* [[RXN1F-462]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) not found ==
+
* [[DIHYDRODIPICSYN-RXN]]
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14000 RXN-14000]
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14001 RXN-14001]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-3803}}
+
* PUBCHEM:
−
{{#set: common name=quercetin triglucoside biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
−
{{#set: reaction found=1}}
+
* CHEBI:
−
{{#set: reaction not found=3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
−
{{#set: completion rate=33.0}}
+
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
 +
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
 +
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
 +
{{#set: molecular weight=185.136    }}
 +
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
 +
{{#set: consumed by=RXN-14014}}
 +
{{#set: produced by=DIHYDRODIPICSYN-RXN}}

Revision as of 21:14, 17 March 2018

Metabolite CPD-14443

  • smiles:
    • C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
  • inchi key:
    • InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
  • common name:
    • (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
  • molecular weight:
    • 185.136
  • Synonym(s):
    • (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-25_000050&oldid=12177"