Difference between revisions of "HEME-BIOSYNTHESIS-II"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...")
 
(Created page with "Category:Gene == Gene Ec-04_001360 == * left end position: ** 1533513 * transcription direction: ** POSITIVE * right end position: ** 1563995 * centisome position: ** 23.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
+
== Gene Ec-04_001360 ==
−
* smiles:
+
* left end position:
−
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
+
** 1533513
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** lotaustralin
+
** 1563995
−
* molecular weight:
+
* centisome position:
−
** 261.274    
+
** 23.549572    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
+
** Esi_0015_0194
 +
** Esi0015_0194
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9674]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-13603]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1533513}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1563995}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
+
{{#set: centisome position=23.549572   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0015_0194|Esi0015_0194}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
+
{{#set: reaction associated=ATPASE-RXN}}
−
* HMDB : HMDB33865
+
−
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
+
−
{{#set: common name=lotaustralin}}
+
−
{{#set: molecular weight=261.274   }}
+
−
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
+
−
{{#set: consumed by=RXN-9674}}
+
−
{{#set: produced by=RXN-13603}}
+

Revision as of 21:14, 17 March 2018

Gene Ec-04_001360

  • left end position:
    • 1533513
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1563995
  • centisome position:
    • 23.549572
  • Synonym(s):
    • Esi_0015_0194
    • Esi0015_0194

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=HEME-BIOSYNTHESIS-II&oldid=12207"