Difference between revisions of "HEME-BIOSYNTHESIS-II"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-04_001360 == * left end position: ** 1533513 * transcription direction: ** POSITIVE * right end position: ** 1563995 * centisome position: ** 23.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_001360 == |
− | * | + | * left end position: |
− | ** | + | ** 1533513 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1563995 |
− | * | + | * centisome position: |
− | ** | + | ** 23.549572 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0015_0194 |
+ | ** Esi0015_0194 | ||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * [[ATPASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | * | + | ***go-term |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=1533513}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1563995}} | |
− | + | {{#set: centisome position=23.549572 }} | |
− | + | {{#set: common name=Esi_0015_0194|Esi0015_0194}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 22:14, 17 March 2018
Gene Ec-04_001360
- left end position:
- 1533513
- transcription direction:
- POSITIVE
- right end position:
- 1563995
- centisome position:
- 23.549572
- Synonym(s):
- Esi_0015_0194
- Esi0015_0194
Reactions associated
- ATPASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome