Difference between revisions of "Ec-27 005100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5406 PWY-5406] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
 +
* inchi key:
 +
** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
 
* common name:
 
* common name:
−
** divinyl ether biosynthesis I
+
** glycerophosphoserine
 +
* molecular weight:
 +
** 258.144   
 
* Synonym(s):
 
* Synonym(s):
−
** 9-lipoxygenase and divinyl ether synthase pathway
 
−
** 9-LOX and DES pathway
 
−
** colneleate biosynthesis
 
−
** colnelenate biosynthesis
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-14136]]
−
* [[RXN-8497]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8495 RXN-8495]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8496 RXN-8496]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8498 RXN-8498]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33090}}
+
* PUBCHEM:
−
{{#set: common name=divinyl ether biosynthesis I}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260]
−
{{#set: common name=9-lipoxygenase and divinyl ether synthase pathway|9-LOX and DES pathway|colneleate biosynthesis|colnelenate biosynthesis}}
+
* CHEBI:
−
{{#set: reaction found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931]
−
{{#set: reaction not found=4}}
+
* BIGG : 1484554
−
{{#set: completion rate=25.0}}
+
{{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}}
 +
{{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}}
 +
{{#set: common name=glycerophosphoserine}}
 +
{{#set: molecular weight=258.144    }}
 +
{{#set: consumed by=RXN-14136}}

Revision as of 21:14, 17 March 2018

Metabolite CPD0-2030

  • smiles:
    • C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
  • inchi key:
    • InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
  • common name:
    • glycerophosphoserine
  • molecular weight:
    • 258.144
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005100&oldid=12227"