Difference between revisions of "Ec-05 001250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17016 RXN-17016] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyl...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17016 RXN-17016] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** cyclic-2,3-O-oxalyl-L-threonate
+
** Glycerol-3-phosphate O-acyltransferase
−
* molecular weight:
+
* ec number:
−
** 189.101   
+
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-cyclic oxalyl theronolactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12872]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Cis-vaccenoyl-ACPs]][c] '''=>''' 1 [[CPD-18348]][c] '''+''' 1 [[ACP]][c]
−
* [[RXN-12869]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a cis-vaccenoyl-[acp][c] '''=>''' 1 1-cis-vaccenoylglycerol-3-phosphate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-01_003960]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
+
{{#set: common name=Glycerol-3-phosphate O-acyltransferase}}
−
{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
+
{{#set: ec number=EC-2.3.1.15}}
−
{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
+
{{#set: gene associated=Ec-01_003960}}
−
{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=189.101    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=2,3-cyclic oxalyl theronolactone}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: consumed by=RXN-12872}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: produced by=RXN-12869}}
+

Revision as of 21:14, 17 March 2018

Reaction RXN-17016

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glycerol-3-phosphate O-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 sn-glycerol 3-phosphate[c] + 1 a cis-vaccenoyl-[acp][c] => 1 1-cis-vaccenoylglycerol-3-phosphate[c] + 1 a holo-[acyl-carrier protein][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_001250&oldid=12236"