Difference between revisions of "REDUCED-MENAQUINONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLORNTRANSAM-RXN ACETYLORNTRANSAM-RXN] == * direction: ** REVERSIBLE * common name: ** Aminotra...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLORNTRANSAM-RXN ACETYLORNTRANSAM-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
 +
* inchi key:
 +
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
 
* common name:
 
* common name:
−
** Aminotransferase class-III
+
** dihydrogeranylgeranyl diphosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.6.1.11 EC-2.6.1.11]
+
** 449.44   
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydroGGPP
 +
** dihydrogeranylgeranyl-PP
 +
** dihydrogeranylgeranyl pyrophosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7659]]
−
** 1 [[N-ALPHA-ACETYLORNITHINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[CPD-469]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7658]]
−
** 1 N-acetyl-L-ornithine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 N-acetyl-L-glutamate 5-semialdehyde[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-14_006580]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5154]], L-arginine biosynthesis III (via N-acetyl-L-citrulline): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5154 PWY-5154]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[GLUTORN-PWY]], L-ornithine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUTORN-PWY GLUTORN-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[ARGSYNBSUB-PWY]], L-arginine biosynthesis II (acetyl cycle): [http://metacyc.org/META/NEW-IMAGE?object=ARGSYNBSUB-PWY ARGSYNBSUB-PWY]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18049 18049]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R02283 R02283]
+
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
−
* UNIPROT:
+
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
−
** [http://www.uniprot.org/uniprot/P18335 P18335]
+
{{#set: molecular weight=449.44    }}
−
** [http://www.uniprot.org/uniprot/Q9PIR7 Q9PIR7]
+
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
−
** [http://www.uniprot.org/uniprot/Q9JTX9 Q9JTX9]
+
{{#set: consumed by=RXN-7659}}
−
** [http://www.uniprot.org/uniprot/Q9CHD3 Q9CHD3]
+
{{#set: produced by=RXN-7658}}
−
** [http://www.uniprot.org/uniprot/P30900 P30900]
+
−
** [http://www.uniprot.org/uniprot/P18544 P18544]
+
−
** [http://www.uniprot.org/uniprot/O74548 O74548]
+
−
** [http://www.uniprot.org/uniprot/O14433 O14433]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=Aminotransferase class-III}}
+
−
{{#set: ec number=EC-2.6.1.11}}
+
−
{{#set: gene associated=Ec-14_006580}}
+
−
{{#set: in pathway=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 21:15, 17 March 2018

Metabolite CPD-7002

  • smiles:
    • CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • inchi key:
    • InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
  • common name:
    • dihydrogeranylgeranyl diphosphate
  • molecular weight:
    • 449.44
  • Synonym(s):
    • dihydroGGPP
    • dihydrogeranylgeranyl-PP
    • dihydrogeranylgeranyl pyrophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=REDUCED-MENAQUINONE&oldid=12250"